C20H28O3 — CID 138964139
methyl (1R,3R,4S,7R,10S,11R)-3-[(E)-but-2-en-2-yl]-4,6,10,11-tetramethyl-2-oxatricyclo[5.3.1.04,11]undeca-5,8-diene-8-carboxylate (PubChem CID 138964139) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is methyl (1R,3R,4S,7R,10S,11R)-3-[(E)-but-2-en-2-yl]-4,6,10,11-tetramethyl-2-oxatricyclo[5.3.1.04,11]undeca-5,8-diene-8-carboxylate.
| Compound Name | methyl (1R,3R,4S,7R,10S,11R)-3-[(E)-but-2-en-2-yl]-4,6,10,11-tetramethyl-2-oxatricyclo[5.3.1.04,11]undeca-5,8-diene-8-carboxylate |
|---|---|
| PubChem CID | 138964139 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | methyl (1R,3R,4S,7R,10S,11R)-3-[(E)-but-2-en-2-yl]-4,6,10,11-tetramethyl-2-oxatricyclo[5.3.1.04,11]undeca-5,8-diene-8-carboxylate |
| SMILES | C/C=C(\C)[C@H]1O[C@@H]2[C@@H](C)C=C(C(=O)OC)[C@@H]3C(C)=C[C@@]1(C)[C@@]32C |
| InChI | InChI=1S/C20H28O3/c1-8-11(2)16-19(5)10-13(4)15-14(18(21)22-7)9-12(3)17(23-16)20(15,19)6/h8-10,12,15-17H,1-7H3/b11-8+/t12-,15-,16+,17+,19+,20-/m0/s1 |
| InChIKey | ZECCVHYHKWOVNB-ASBIXVLJSA-N |
| XLogP | 4.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|