C18H18F3NO2 — CID 138964159
(2S)-4,4,4-trifluoro-2-(2-hydroxyethyl)-N,2-diphenylbutanamide (PubChem CID 138964159) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is (2S)-4,4,4-trifluoro-2-(2-hydroxyethyl)-N,2-diphenylbutanamide.
| Compound Name | (2S)-4,4,4-trifluoro-2-(2-hydroxyethyl)-N,2-diphenylbutanamide |
|---|---|
| PubChem CID | 138964159 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2S)-4,4,4-trifluoro-2-(2-hydroxyethyl)-N,2-diphenylbutanamide |
| SMILES | O=C(Nc1ccccc1)[C@@](CCO)(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H18F3NO2/c19-18(20,21)13-17(11-12-23,14-7-3-1-4-8-14)16(24)22-15-9-5-2-6-10-15/h1-10,23H,11-13H2,(H,22,24)/t17-/m0/s1 |
| InChIKey | HLERYRYTFUTBOC-KRWDZBQOSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |