C32H35NO2 — CID 138964182
5,11,17-tritert-butyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione (PubChem CID 138964182) has the molecular formula C32H35NO2 and a molecular weight of 465.64 g/mol. Its IUPAC name is 5,11,17-tritert-butyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione.
| Compound Name | 5,11,17-tritert-butyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione |
|---|---|
| PubChem CID | 138964182 |
| Molecular Formula | C32H35NO2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 5,11,17-tritert-butyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione |
| SMILES | CC(C)(C)c1ccc2c(c1)c(=O)c1cc(C(C)(C)C)cc3c(=O)c4cc(C(C)(C)C)ccc4n2c13 |
| InChI | InChI=1S/C32H35NO2/c1-30(2,3)18-10-12-25-21(14-18)28(34)23-16-20(32(7,8)9)17-24-27(23)33(25)26-13-11-19(31(4,5)6)15-22(26)29(24)35/h10-17H,1-9H3 |
| InChIKey | IIBATBMKAPUBKM-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 38.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|