About (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one
(5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one (PubChem CID 138964267) has the molecular formula C14H11F6NO
and a molecular weight of 323.24 g/mol. Its IUPAC name is (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one |
| PubChem CID | 138964267 |
| Molecular Formula | C14H11F6NO |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](/C=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C14H11F6NO/c15-13(16,17)9-5-8(6-10(7-9)14(18,19)20)1-2-11-3-4-12(22)21-11/h1-2,5-7,11H,3-4H2,(H,21,22)/b2-1+/t11-/m0/s1 |
| InChIKey | CYGRGWJTNARTBY-GXFZAYBSSA-N |
| XLogP | 4.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one?
The IUPAC name of (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one (CID 138964267) is (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one.
What is the SMILES notation for (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one?
The canonical SMILES for (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one is O=C1CC[C@H](/C=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)N1.
What is the InChIKey of (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one?
The InChIKey is CYGRGWJTNARTBY-GXFZAYBSSA-N. The full InChI is InChI=1S/C14H11F6NO/c15-13(16,17)9-5-8(6-10(7-9)14(18,19)20)1-2-11-3-4-12(22)21-11/h1-2,5-7,11H,3-4H2,(H,21,22)/b2-1+/t11-/m0/s1.
What are the key properties of (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one?
(5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one has a molecular weight of 323.24 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]pyrrolidin-2-one is sourced from PubChem (CID 138964267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).