About (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine
(2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine (PubChem CID 138964295) has the molecular formula C18H18N2O3S
and a molecular weight of 342.42 g/mol. Its IUPAC name is (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine.
Molecular Properties
| Compound Name | (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine |
| PubChem CID | 138964295 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine |
| SMILES | C=C[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C=C(c2ccccn2)O1 |
| InChI | InChI=1S/C18H18N2O3S/c1-3-15-12-20(13-18(23-15)17-6-4-5-11-19-17)24(21,22)16-9-7-14(2)8-10-16/h3-11,13,15H,1,12H2,2H3/t15-/m0/s1 |
| InChIKey | NKOPLENQIKGEIS-HNNXBMFYSA-N |
| XLogP | 2.96 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine?
The IUPAC name of (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine (CID 138964295) is (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine.
What is the SMILES notation for (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine?
The canonical SMILES for (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine is C=C[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C=C(c2ccccn2)O1.
What is the InChIKey of (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine?
The InChIKey is NKOPLENQIKGEIS-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H18N2O3S/c1-3-15-12-20(13-18(23-15)17-6-4-5-11-19-17)24(21,22)16-9-7-14(2)8-10-16/h3-11,13,15H,1,12H2,2H3/t15-/m0/s1.
What are the key properties of (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine?
(2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine has a molecular weight of 342.42 g/mol, XLogP of 2.96, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-ethenyl-4-(4-methylphenyl)sulfonyl-6-pyridin-2-yl-2,3-dihydro-1,4-oxazine is sourced from PubChem (CID 138964295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).