About phenacyl N,N-diethylcarbamate
phenacyl N,N-diethylcarbamate (PubChem CID 138964297) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is phenacyl N,N-diethylcarbamate.
Molecular Properties
| Compound Name | phenacyl N,N-diethylcarbamate |
| PubChem CID | 138964297 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | phenacyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c1-3-14(4-2)13(16)17-10-12(15)11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | KDLKTXNIQGYEQM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenacyl N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl N,N-diethylcarbamate?
The IUPAC name of phenacyl N,N-diethylcarbamate (CID 138964297) is phenacyl N,N-diethylcarbamate.
What is the SMILES notation for phenacyl N,N-diethylcarbamate?
The canonical SMILES for phenacyl N,N-diethylcarbamate is CCN(CC)C(=O)OCC(=O)c1ccccc1.
What is the InChIKey of phenacyl N,N-diethylcarbamate?
The InChIKey is KDLKTXNIQGYEQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-3-14(4-2)13(16)17-10-12(15)11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3.
What are the key properties of phenacyl N,N-diethylcarbamate?
phenacyl N,N-diethylcarbamate has a molecular weight of 235.28 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl N,N-diethylcarbamate is sourced from PubChem (CID 138964297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).