C23H20N2O4S — CID 138964315
(9S)-1'-(3-methylbut-2-enyl)-5,5-dioxospiro[8H-pyrido[1,2-b][1,2]benzothiazole-9,3'-indole]-2',7-dione (PubChem CID 138964315) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is (9S)-1'-(3-methylbut-2-enyl)-5,5-dioxospiro[8H-pyrido[1,2-b][1,2]benzothiazole-9,3'-indole]-2',7-dione.
| Compound Name | (9S)-1'-(3-methylbut-2-enyl)-5,5-dioxospiro[8H-pyrido[1,2-b][1,2]benzothiazole-9,3'-indole]-2',7-dione |
|---|---|
| PubChem CID | 138964315 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (9S)-1'-(3-methylbut-2-enyl)-5,5-dioxospiro[8H-pyrido[1,2-b][1,2]benzothiazole-9,3'-indole]-2',7-dione |
| SMILES | CC(C)=CCN1C(=O)[C@@]2(C=C3c4ccccc4S(=O)(=O)N3C(=O)C2)c2ccccc21 |
| InChI | InChI=1S/C23H20N2O4S/c1-15(2)11-12-24-18-9-5-4-8-17(18)23(22(24)27)13-19-16-7-3-6-10-20(16)30(28,29)25(19)21(26)14-23/h3-11,13H,12,14H2,1-2H3/t23-/m1/s1 |
| InChIKey | XLVMQFCCXAXMAD-HSZRJFAPSA-N |
| XLogP | 3.21 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|