C19H17F2NO3S — CID 138964361
(2S)-6-(2,4-difluorophenyl)-2-ethenyl-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-oxazine (PubChem CID 138964361) has the molecular formula C19H17F2NO3S and a molecular weight of 377.41 g/mol. Its IUPAC name is (2S)-6-(2,4-difluorophenyl)-2-ethenyl-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-oxazine.
| Compound Name | (2S)-6-(2,4-difluorophenyl)-2-ethenyl-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-oxazine |
|---|---|
| PubChem CID | 138964361 |
| Molecular Formula | C19H17F2NO3S |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (2S)-6-(2,4-difluorophenyl)-2-ethenyl-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-oxazine |
| SMILES | C=C[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C=C(c2ccc(F)cc2F)O1 |
| InChI | InChI=1S/C19H17F2NO3S/c1-3-15-11-22(26(23,24)16-7-4-13(2)5-8-16)12-19(25-15)17-9-6-14(20)10-18(17)21/h3-10,12,15H,1,11H2,2H3/t15-/m0/s1 |
| InChIKey | LVGJQBJXIMXQNN-HNNXBMFYSA-N |
| XLogP | 3.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|