About (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol
(1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol (PubChem CID 138964368) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol.
Molecular Properties
| Compound Name | (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol |
| PubChem CID | 138964368 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol |
| SMILES | C=C(C)C(C)(C)[C@@H](O)c1ccoc1 |
| InChI | InChI=1S/C11H16O2/c1-8(2)11(3,4)10(12)9-5-6-13-7-9/h5-7,10,12H,1H2,2-4H3/t10-/m0/s1 |
| InChIKey | KBVGDFBMUZBLLR-JTQLQIEISA-N |
| XLogP | 2.92 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol?
The IUPAC name of (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol (CID 138964368) is (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol.
What is the SMILES notation for (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol?
The canonical SMILES for (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol is C=C(C)C(C)(C)[C@@H](O)c1ccoc1.
What is the InChIKey of (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol?
The InChIKey is KBVGDFBMUZBLLR-JTQLQIEISA-N. The full InChI is InChI=1S/C11H16O2/c1-8(2)11(3,4)10(12)9-5-6-13-7-9/h5-7,10,12H,1H2,2-4H3/t10-/m0/s1.
What are the key properties of (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol?
(1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol has a molecular weight of 180.25 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(furan-3-yl)-2,2,3-trimethylbut-3-en-1-ol is sourced from PubChem (CID 138964368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).