C13H13NO — CID 138964484
(4aR,10bR)-2,4a,5,10b-tetrahydro-1H-phenanthridin-6-one (PubChem CID 138964484) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is (4aR,10bR)-2,4a,5,10b-tetrahydro-1H-phenanthridin-6-one.
| Compound Name | (4aR,10bR)-2,4a,5,10b-tetrahydro-1H-phenanthridin-6-one |
|---|---|
| PubChem CID | 138964484 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (4aR,10bR)-2,4a,5,10b-tetrahydro-1H-phenanthridin-6-one |
| SMILES | O=C1N[C@@H]2C=CCC[C@@H]2c2ccccc21 |
| InChI | InChI=1S/C13H13NO/c15-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)14-13/h1-2,4-5,7-8,10,12H,3,6H2,(H,14,15)/t10-,12-/m1/s1 |
| InChIKey | QZGAWOCVZAAUIL-ZYHUDNBSSA-N |
| XLogP | 2.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|