C16H25NO3 — CID 138964639
(3E,5Z)-6-butan-2-yl-1-oxa-8-azacyclotetradeca-3,5-diene-2,7-dione (PubChem CID 138964639) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (3E,5Z)-6-butan-2-yl-1-oxa-8-azacyclotetradeca-3,5-diene-2,7-dione.
| Compound Name | (3E,5Z)-6-butan-2-yl-1-oxa-8-azacyclotetradeca-3,5-diene-2,7-dione |
|---|---|
| PubChem CID | 138964639 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (3E,5Z)-6-butan-2-yl-1-oxa-8-azacyclotetradeca-3,5-diene-2,7-dione |
| SMILES | CCC(C)/C1=C/C=C/C(=O)OCCCCCCNC1=O |
| InChI | InChI=1S/C16H25NO3/c1-3-13(2)14-9-8-10-15(18)20-12-7-5-4-6-11-17-16(14)19/h8-10,13H,3-7,11-12H2,1-2H3,(H,17,19)/b10-8+,14-9- |
| InChIKey | BAHJQGJOYJTHBA-VMXBWBJUSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |