About 4-methyl-1-phenylindole
4-methyl-1-phenylindole (PubChem CID 138964714) has the molecular formula C15H13N
and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-methyl-1-phenylindole.
Molecular Properties
| Compound Name | 4-methyl-1-phenylindole |
| PubChem CID | 138964714 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-methyl-1-phenylindole |
| SMILES | Cc1cccc2c1ccn2-c1ccccc1 |
| InChI | InChI=1S/C15H13N/c1-12-6-5-9-15-14(12)10-11-16(15)13-7-3-2-4-8-13/h2-11H,1H3 |
| InChIKey | LAMLXZSJJXDIJV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-1-phenylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-phenylindole?
The IUPAC name of 4-methyl-1-phenylindole (CID 138964714) is 4-methyl-1-phenylindole.
What is the SMILES notation for 4-methyl-1-phenylindole?
The canonical SMILES for 4-methyl-1-phenylindole is Cc1cccc2c1ccn2-c1ccccc1.
What is the InChIKey of 4-methyl-1-phenylindole?
The InChIKey is LAMLXZSJJXDIJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N/c1-12-6-5-9-15-14(12)10-11-16(15)13-7-3-2-4-8-13/h2-11H,1H3.
What are the key properties of 4-methyl-1-phenylindole?
4-methyl-1-phenylindole has a molecular weight of 207.28 g/mol, XLogP of 3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-phenylindole is sourced from PubChem (CID 138964714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).