About (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone
(4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone (PubChem CID 138964804) has the molecular formula C23H21ClFNO
and a molecular weight of 381.88 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone |
| PubChem CID | 138964804 |
| Molecular Formula | C23H21ClFNO |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone |
| SMILES | CC1=C(C(=O)c2ccc(Cl)cc2)C(c2cccc(F)c2)=NC12CCCCC2 |
| InChI | InChI=1S/C23H21ClFNO/c1-15-20(22(27)16-8-10-18(24)11-9-16)21(17-6-5-7-19(25)14-17)26-23(15)12-3-2-4-13-23/h5-11,14H,2-4,12-13H2,1H3 |
| InChIKey | PKAPQONUHJNRGQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone?
The IUPAC name of (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone (CID 138964804) is (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone.
What is the SMILES notation for (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone?
The canonical SMILES for (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone is CC1=C(C(=O)c2ccc(Cl)cc2)C(c2cccc(F)c2)=NC12CCCCC2.
What is the InChIKey of (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone?
The InChIKey is PKAPQONUHJNRGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21ClFNO/c1-15-20(22(27)16-8-10-18(24)11-9-16)21(17-6-5-7-19(25)14-17)26-23(15)12-3-2-4-13-23/h5-11,14H,2-4,12-13H2,1H3.
What are the key properties of (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone?
(4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone has a molecular weight of 381.88 g/mol, XLogP of 6.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[2-(3-fluorophenyl)-4-methyl-1-azaspiro[4.5]deca-1,3-dien-3-yl]methanone is sourced from PubChem (CID 138964804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).