About tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate
tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate (PubChem CID 138964826) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate.
Analyze tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate?
The IUPAC name of tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate (CID 138964826) is tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate.
What is the SMILES notation for tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate?
The canonical SMILES for tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate is CC(C)(C)OC(=O)N1C/C=C\C(=O)CCC1.
What is the InChIKey of tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate?
The InChIKey is RYLUPHVVLNLSEQ-XQRVVYSFSA-N. The full InChI is InChI=1S/C12H19NO3/c1-12(2,3)16-11(15)13-8-4-6-10(14)7-5-9-13/h4,6H,5,7-9H2,1-3H3/b6-4-.
What are the key properties of tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate?
tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate has a molecular weight of 225.29 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (6Z)-5-oxo-2,3,4,8-tetrahydroazocine-1-carboxylate is sourced from PubChem (CID 138964826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).