About diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate
diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate (PubChem CID 138964853) has the molecular formula C14H15BrN2O4
and a molecular weight of 355.19 g/mol. Its IUPAC name is diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate.
Molecular Properties
| Compound Name | diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate |
| PubChem CID | 138964853 |
| Molecular Formula | C14H15BrN2O4 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1cc2cc(Br)cnc2[nH]1 |
| InChI | InChI=1S/C14H15BrN2O4/c1-3-20-13(18)11(14(19)21-4-2)10-6-8-5-9(15)7-16-12(8)17-10/h5-7,11H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | DRXSCWDQIYZGNR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate?
The IUPAC name of diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate (CID 138964853) is diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate.
What is the SMILES notation for diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate?
The canonical SMILES for diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate is CCOC(=O)C(C(=O)OCC)c1cc2cc(Br)cnc2[nH]1.
What is the InChIKey of diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate?
The InChIKey is DRXSCWDQIYZGNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN2O4/c1-3-20-13(18)11(14(19)21-4-2)10-6-8-5-9(15)7-16-12(8)17-10/h5-7,11H,3-4H2,1-2H3,(H,16,17).
What are the key properties of diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate?
diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate has a molecular weight of 355.19 g/mol, XLogP of 2.54, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(5-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)propanedioate is sourced from PubChem (CID 138964853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).