About CID 138964905
CID 138964905 (PubChem CID 138964905) has the molecular formula C11H8F3NO3PdSSi
and a molecular weight of 425.76 g/mol.
Molecular Properties
| Compound Name | CID 138964905 |
| PubChem CID | 138964905 |
| Molecular Formula | C11H8F3NO3PdSSi |
| Molecular Weight | 425.76 g/mol |
| Exact Mass | 424.90 |
| IUPAC Name | — |
| SMILES | O=S(=O)([O-])C(F)(F)F.[Pd+2].[c-]1ccccc1[Si]c1ccc[nH]1 |
| InChI | InChI=1S/C10H8NSi.CHF3O3S.Pd/c1-2-5-9(6-3-1)12-10-7-4-8-11-10;2-1(3,4)8(5,6)7;/h1-5,7-8,11H;(H,5,6,7);/q-1;;+2/p-1 |
| InChIKey | KVWJVEKFCJTSBJ-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.76 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze CID 138964905 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138964905?
The IUPAC name of CID 138964905 (CID 138964905) is not available.
What is the SMILES notation for CID 138964905?
The canonical SMILES for CID 138964905 is O=S(=O)([O-])C(F)(F)F.[Pd+2].[c-]1ccccc1[Si]c1ccc[nH]1.
What is the InChIKey of CID 138964905?
The InChIKey is KVWJVEKFCJTSBJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8NSi.CHF3O3S.Pd/c1-2-5-9(6-3-1)12-10-7-4-8-11-10;2-1(3,4)8(5,6)7;/h1-5,7-8,11H;(H,5,6,7);/q-1;;+2/p-1.
What are the key properties of CID 138964905?
CID 138964905 has a molecular weight of 425.76 g/mol, XLogP of 0.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138964905 is sourced from PubChem (CID 138964905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).