C16H27BrO2 — CID 138964942
methyl (E)-5-(3-bromo-2,2,6-trimethylcyclohexyl)-3-methylpent-2-enoate (PubChem CID 138964942) has the molecular formula C16H27BrO2 and a molecular weight of 331.29 g/mol. Its IUPAC name is methyl (E)-5-(3-bromo-2,2,6-trimethylcyclohexyl)-3-methylpent-2-enoate.
| Compound Name | methyl (E)-5-(3-bromo-2,2,6-trimethylcyclohexyl)-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 138964942 |
| Molecular Formula | C16H27BrO2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl (E)-5-(3-bromo-2,2,6-trimethylcyclohexyl)-3-methylpent-2-enoate |
| SMILES | COC(=O)/C=C(\C)CCC1C(C)CCC(Br)C1(C)C |
| InChI | InChI=1S/C16H27BrO2/c1-11(10-15(18)19-5)6-8-13-12(2)7-9-14(17)16(13,3)4/h10,12-14H,6-9H2,1-5H3/b11-10+ |
| InChIKey | HCRJIAFQTZPUGK-ZHACJKMWSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|