C14H11F6NO4 — CID 138964962
1,1,1,3,3,3-hexafluoropropan-2-yl 2-(phenylmethoxycarbonylamino)prop-2-enoate (PubChem CID 138964962) has the molecular formula C14H11F6NO4 and a molecular weight of 371.23 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(phenylmethoxycarbonylamino)prop-2-enoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(phenylmethoxycarbonylamino)prop-2-enoate |
|---|---|
| PubChem CID | 138964962 |
| Molecular Formula | C14H11F6NO4 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(phenylmethoxycarbonylamino)prop-2-enoate |
| SMILES | C=C(NC(=O)OCc1ccccc1)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H11F6NO4/c1-8(10(22)25-11(13(15,16)17)14(18,19)20)21-12(23)24-7-9-5-3-2-4-6-9/h2-6,11H,1,7H2,(H,21,23) |
| InChIKey | CGOLDWZDAGVUOM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|