C10H15NO — CID 138965083
5,5-bis(prop-2-enyl)pyrrolidin-2-one (PubChem CID 138965083) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 5,5-bis(prop-2-enyl)pyrrolidin-2-one.
| Compound Name | 5,5-bis(prop-2-enyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 138965083 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 5,5-bis(prop-2-enyl)pyrrolidin-2-one |
| SMILES | C=CCC1(CC=C)CCC(=O)N1 |
| InChI | InChI=1S/C10H15NO/c1-3-6-10(7-4-2)8-5-9(12)11-10/h3-4H,1-2,5-8H2,(H,11,12) |
| InChIKey | FUHQKFHKEXMVAE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|