About benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium
benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium (PubChem CID 1389651) has the molecular formula C22H30NO+
and a molecular weight of 324.49 g/mol. Its IUPAC name is benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium.
Molecular Properties
| Compound Name | benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium |
| PubChem CID | 1389651 |
| Molecular Formula | C22H30NO+ |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium |
| SMILES | CC1(C)C[C@@H]([NH+](CCc2ccccc2)Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C22H29NO/c1-22(2)17-21(14-16-24-22)23(18-20-11-7-4-8-12-20)15-13-19-9-5-3-6-10-19/h3-12,21H,13-18H2,1-2H3/p+1/t21-/m0/s1 |
| InChIKey | GAKCBJCFHBDGKB-NRFANRHFSA-O |
| XLogP | 3.27 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium?
The IUPAC name of benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium (CID 1389651) is benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium.
What is the SMILES notation for benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium?
The canonical SMILES for benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium is CC1(C)C[C@@H]([NH+](CCc2ccccc2)Cc2ccccc2)CCO1.
What is the InChIKey of benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium?
The InChIKey is GAKCBJCFHBDGKB-NRFANRHFSA-O. The full InChI is InChI=1S/C22H29NO/c1-22(2)17-21(14-16-24-22)23(18-20-11-7-4-8-12-20)15-13-19-9-5-3-6-10-19/h3-12,21H,13-18H2,1-2H3/p+1/t21-/m0/s1.
What are the key properties of benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium?
benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium has a molecular weight of 324.49 g/mol, XLogP of 3.27, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[(4S)-2,2-dimethyloxan-4-yl]-(2-phenylethyl)azanium is sourced from PubChem (CID 1389651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).