C19H16F3N2O2+ — CID 138965101
methyl 1-methyl-3-phenyl-4-pyridin-1-ium-1-yl-5-(trifluoromethyl)pyrrole-2-carboxylate (PubChem CID 138965101) has the molecular formula C19H16F3N2O2+ and a molecular weight of 361.34 g/mol. Its IUPAC name is methyl 1-methyl-3-phenyl-4-pyridin-1-ium-1-yl-5-(trifluoromethyl)pyrrole-2-carboxylate.
| Compound Name | methyl 1-methyl-3-phenyl-4-pyridin-1-ium-1-yl-5-(trifluoromethyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 138965101 |
| Molecular Formula | C19H16F3N2O2+ |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | methyl 1-methyl-3-phenyl-4-pyridin-1-ium-1-yl-5-(trifluoromethyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)c(-[n+]2ccccc2)c(C(F)(F)F)n1C |
| InChI | InChI=1S/C19H16F3N2O2/c1-23-16(18(25)26-2)14(13-9-5-3-6-10-13)15(17(23)19(20,21)22)24-11-7-4-8-12-24/h3-12H,1-2H3/q+1 |
| InChIKey | AGWJIILJKIMRMB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|