C35H34N2O — CID 138965125
2-[2-[[(1R,2R)-1,2-diphenyl-2-(2,4,6-trimethylanilino)ethyl]amino]phenyl]phenol (PubChem CID 138965125) has the molecular formula C35H34N2O and a molecular weight of 498.67 g/mol. Its IUPAC name is 2-[2-[[(1R,2R)-1,2-diphenyl-2-(2,4,6-trimethylanilino)ethyl]amino]phenyl]phenol.
| Compound Name | 2-[2-[[(1R,2R)-1,2-diphenyl-2-(2,4,6-trimethylanilino)ethyl]amino]phenyl]phenol |
|---|---|
| PubChem CID | 138965125 |
| Molecular Formula | C35H34N2O |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 2-[2-[[(1R,2R)-1,2-diphenyl-2-(2,4,6-trimethylanilino)ethyl]amino]phenyl]phenol |
| SMILES | Cc1cc(C)c(N[C@H](c2ccccc2)[C@H](Nc2ccccc2-c2ccccc2O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C35H34N2O/c1-24-22-25(2)33(26(3)23-24)37-35(28-16-8-5-9-17-28)34(27-14-6-4-7-15-27)36-31-20-12-10-18-29(31)30-19-11-13-21-32(30)38/h4-23,34-38H,1-3H3/t34-,35-/m1/s1 |
| InChIKey | ZXUXHSKNOIFFKH-VSJLXWSYSA-N |
| XLogP | 8.99 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |