C24H28BrNO — CID 138965131
(4S)-2-[11-(bromomethyl)-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-4-tert-butyl-4,5-dihydro-1,3-oxazole (PubChem CID 138965131) has the molecular formula C24H28BrNO and a molecular weight of 426.40 g/mol. Its IUPAC name is (4S)-2-[11-(bromomethyl)-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-4-tert-butyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[11-(bromomethyl)-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-4-tert-butyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 138965131 |
| Molecular Formula | C24H28BrNO |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (4S)-2-[11-(bromomethyl)-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-4-tert-butyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C)[C@H]1COC(c2cc3ccc2CCc2ccc(c(CBr)c2)CC3)=N1 |
| InChI | InChI=1S/C24H28BrNO/c1-24(2,3)22-15-27-23(26-22)21-13-17-5-9-18-8-4-16(12-20(18)14-25)6-10-19(21)11-7-17/h4,7-8,11-13,22H,5-6,9-10,14-15H2,1-3H3/t22-/m1/s1 |
| InChIKey | WHCVWMBJKVLIKM-JOCHJYFZSA-N |
| XLogP | 5.66 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|