C44H34Cl3NO11 — CID 138965163
[(3R,6S)-4,5-dibenzoyloxy-2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate (PubChem CID 138965163) has the molecular formula C44H34Cl3NO11 and a molecular weight of 859.11 g/mol. Its IUPAC name is [(3R,6S)-4,5-dibenzoyloxy-2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate.
| Compound Name | [(3R,6S)-4,5-dibenzoyloxy-2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 138965163 |
| Molecular Formula | C44H34Cl3NO11 |
| Molecular Weight | 859.11 g/mol |
| Exact Mass | 857.12 |
| IUPAC Name | [(3R,6S)-4,5-dibenzoyloxy-2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
| SMILES | [H]/N=C(/O[C@@H]1OC(COC(=O)OCC2c3ccccc3-c3ccccc32)[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C44H34Cl3NO11/c45-44(46,47)42(48)59-41-37(58-40(51)28-18-8-3-9-19-28)36(57-39(50)27-16-6-2-7-17-27)35(56-38(49)26-14-4-1-5-15-26)34(55-41)25-54-43(52)53-24-33-31-22-12-10-20-29(31)30-21-11-13-23-32(30)33/h1-23,33-37,41,48H,24-25H2/b48-42+/t34?,35-,36?,37?,41+/m1/s1 |
| InChIKey | JZXXINIJPDNHLX-MYELKSKESA-N |
| XLogP | 8.72 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.11 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|