C18H26O2 — CID 138965250
[5-methyl-1-[(1R)-1,5,5-trimethylcyclohex-2-en-1-yl]hex-5-en-3-yn-2-yl] acetate (PubChem CID 138965250) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is [5-methyl-1-[(1R)-1,5,5-trimethylcyclohex-2-en-1-yl]hex-5-en-3-yn-2-yl] acetate.
| Compound Name | [5-methyl-1-[(1R)-1,5,5-trimethylcyclohex-2-en-1-yl]hex-5-en-3-yn-2-yl] acetate |
|---|---|
| PubChem CID | 138965250 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | [5-methyl-1-[(1R)-1,5,5-trimethylcyclohex-2-en-1-yl]hex-5-en-3-yn-2-yl] acetate |
| SMILES | C=C(C)C#CC(C[C@]1(C)C=CCC(C)(C)C1)OC(C)=O |
| InChI | InChI=1S/C18H26O2/c1-14(2)8-9-16(20-15(3)19)12-18(6)11-7-10-17(4,5)13-18/h7,11,16H,1,10,12-13H2,2-6H3/t16?,18-/m0/s1 |
| InChIKey | SUGDZAQYVTUBJP-DAFXYXGESA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|