C23H36O5 — CID 138965251
diethyl 2-[3-[(3aS,7aR)-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-3H-inden-1-yl]-2-methyl-3-oxopropyl]propanedioate (PubChem CID 138965251) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is diethyl 2-[3-[(3aS,7aR)-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-3H-inden-1-yl]-2-methyl-3-oxopropyl]propanedioate.
| Compound Name | diethyl 2-[3-[(3aS,7aR)-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-3H-inden-1-yl]-2-methyl-3-oxopropyl]propanedioate |
|---|---|
| PubChem CID | 138965251 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | diethyl 2-[3-[(3aS,7aR)-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-3H-inden-1-yl]-2-methyl-3-oxopropyl]propanedioate |
| SMILES | CCOC(=O)C(CC(C)C(=O)C1=CC[C@@]2(C)CC(C)(C)CC[C@@H]12)C(=O)OCC |
| InChI | InChI=1S/C23H36O5/c1-7-27-20(25)17(21(26)28-8-2)13-15(3)19(24)16-9-12-23(6)14-22(4,5)11-10-18(16)23/h9,15,17-18H,7-8,10-14H2,1-6H3/t15?,18-,23-/m0/s1 |
| InChIKey | ZPMONRUYOGDFSE-UEHPTQOCSA-N |
| XLogP | 4.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|