C12H15BrO3 — CID 138965385
methyl (E)-4-[(1R,5R)-3-bromo-5-ethyl-2-oxocyclopent-3-en-1-yl]but-2-enoate (PubChem CID 138965385) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is methyl (E)-4-[(1R,5R)-3-bromo-5-ethyl-2-oxocyclopent-3-en-1-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[(1R,5R)-3-bromo-5-ethyl-2-oxocyclopent-3-en-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 138965385 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | methyl (E)-4-[(1R,5R)-3-bromo-5-ethyl-2-oxocyclopent-3-en-1-yl]but-2-enoate |
| SMILES | CC[C@H]1C=C(Br)C(=O)[C@@H]1C/C=C/C(=O)OC |
| InChI | InChI=1S/C12H15BrO3/c1-3-8-7-10(13)12(15)9(8)5-4-6-11(14)16-2/h4,6-9H,3,5H2,1-2H3/b6-4+/t8-,9+/m0/s1 |
| InChIKey | DBQXSXMLBNTLMR-HNEWHRDISA-N |
| XLogP | 2.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|