C15H18O4 — CID 138965416
(2R,4S,4aR,8aR)-3',4,7-trimethylspiro[4,4a,5,8a-tetrahydro-3H-chromene-2,5'-furan]-2',8-dione (PubChem CID 138965416) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (2R,4S,4aR,8aR)-3',4,7-trimethylspiro[4,4a,5,8a-tetrahydro-3H-chromene-2,5'-furan]-2',8-dione.
| Compound Name | (2R,4S,4aR,8aR)-3',4,7-trimethylspiro[4,4a,5,8a-tetrahydro-3H-chromene-2,5'-furan]-2',8-dione |
|---|---|
| PubChem CID | 138965416 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2R,4S,4aR,8aR)-3',4,7-trimethylspiro[4,4a,5,8a-tetrahydro-3H-chromene-2,5'-furan]-2',8-dione |
| SMILES | CC1=C[C@@]2(C[C@H](C)[C@H]3CC=C(C)C(=O)[C@@H]3O2)OC1=O |
| InChI | InChI=1S/C15H18O4/c1-8-4-5-11-9(2)6-15(18-13(11)12(8)16)7-10(3)14(17)19-15/h4,7,9,11,13H,5-6H2,1-3H3/t9-,11+,13+,15+/m0/s1 |
| InChIKey | KWPMLXVTPVBVIU-AGNJHWRGSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |