About 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine
4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine (PubChem CID 138965440) has the molecular formula C20H27F2NO
and a molecular weight of 335.44 g/mol. Its IUPAC name is 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine.
Molecular Properties
| Compound Name | 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine |
| PubChem CID | 138965440 |
| Molecular Formula | C20H27F2NO |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine |
| SMILES | CC1(CC(=C(F)F)c2ccc(N3CCOCC3)cc2)CCCCC1 |
| InChI | InChI=1S/C20H27F2NO/c1-20(9-3-2-4-10-20)15-18(19(21)22)16-5-7-17(8-6-16)23-11-13-24-14-12-23/h5-8H,2-4,9-15H2,1H3 |
| InChIKey | JGILQPVEAGEAAV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine?
The IUPAC name of 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine (CID 138965440) is 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine.
What is the SMILES notation for 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine?
The canonical SMILES for 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine is CC1(CC(=C(F)F)c2ccc(N3CCOCC3)cc2)CCCCC1.
What is the InChIKey of 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine?
The InChIKey is JGILQPVEAGEAAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27F2NO/c1-20(9-3-2-4-10-20)15-18(19(21)22)16-5-7-17(8-6-16)23-11-13-24-14-12-23/h5-8H,2-4,9-15H2,1H3.
What are the key properties of 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine?
4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine has a molecular weight of 335.44 g/mol, XLogP of 5.49, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[1,1-difluoro-3-(1-methylcyclohexyl)prop-1-en-2-yl]phenyl]morpholine is sourced from PubChem (CID 138965440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).