About 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene
1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene (PubChem CID 138965443) has the molecular formula C24H21ClF2O
and a molecular weight of 398.88 g/mol. Its IUPAC name is 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene.
Molecular Properties
| Compound Name | 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene |
| PubChem CID | 138965443 |
| Molecular Formula | C24H21ClF2O |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene |
| SMILES | CC(C)(CC(=C(F)F)c1ccc(-c2ccccc2)cc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClF2O/c1-24(2,28-21-14-12-20(25)13-15-21)16-22(23(26)27)19-10-8-18(9-11-19)17-6-4-3-5-7-17/h3-15H,16H2,1-2H3 |
| InChIKey | SQLVIPKKKCIBRZ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene?
The IUPAC name of 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene (CID 138965443) is 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene.
What is the SMILES notation for 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene?
The canonical SMILES for 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene is CC(C)(CC(=C(F)F)c1ccc(-c2ccccc2)cc1)Oc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene?
The InChIKey is SQLVIPKKKCIBRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21ClF2O/c1-24(2,28-21-14-12-20(25)13-15-21)16-22(23(26)27)19-10-8-18(9-11-19)17-6-4-3-5-7-17/h3-15H,16H2,1-2H3.
What are the key properties of 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene?
1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene has a molecular weight of 398.88 g/mol, XLogP of 7.86, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[5,5-difluoro-2-methyl-4-(4-phenylphenyl)pent-4-en-2-yl]oxybenzene is sourced from PubChem (CID 138965443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).