C22H36O6 — CID 138965543
methyl (1R,3S,3aR,4S,6R,8aR)-1,3-dimethoxy-5-oxo-6-[(1S)-1,3,3-trimethylcyclohexyl]-1,3,3a,4,6,7,8,8a-octahydrocyclohepta[c]furan-4-carboxylate (PubChem CID 138965543) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is methyl (1R,3S,3aR,4S,6R,8aR)-1,3-dimethoxy-5-oxo-6-[(1S)-1,3,3-trimethylcyclohexyl]-1,3,3a,4,6,7,8,8a-octahydrocyclohepta[c]furan-4-carboxylate.
| Compound Name | methyl (1R,3S,3aR,4S,6R,8aR)-1,3-dimethoxy-5-oxo-6-[(1S)-1,3,3-trimethylcyclohexyl]-1,3,3a,4,6,7,8,8a-octahydrocyclohepta[c]furan-4-carboxylate |
|---|---|
| PubChem CID | 138965543 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | methyl (1R,3S,3aR,4S,6R,8aR)-1,3-dimethoxy-5-oxo-6-[(1S)-1,3,3-trimethylcyclohexyl]-1,3,3a,4,6,7,8,8a-octahydrocyclohepta[c]furan-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)[C@@H]([C@@]2(C)CCCC(C)(C)C2)CC[C@H]2[C@H](OC)O[C@H](OC)[C@@H]12 |
| InChI | InChI=1S/C22H36O6/c1-21(2)10-7-11-22(3,12-21)14-9-8-13-15(16(17(14)23)18(24)25-4)20(27-6)28-19(13)26-5/h13-16,19-20H,7-12H2,1-6H3/t13-,14+,15-,16+,19-,20+,22+/m1/s1 |
| InChIKey | RVHIMMKAQBNPBR-HVJJXDSXSA-N |
| XLogP | 3.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|