C23H35F6N3OSSi — CID 138965657
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-pyrrolidin-1-ylbutan-2-yl]thiourea (PubChem CID 138965657) has the molecular formula C23H35F6N3OSSi and a molecular weight of 543.69 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-pyrrolidin-1-ylbutan-2-yl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-pyrrolidin-1-ylbutan-2-yl]thiourea |
|---|---|
| PubChem CID | 138965657 |
| Molecular Formula | C23H35F6N3OSSi |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-pyrrolidin-1-ylbutan-2-yl]thiourea |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CN1CCCC1)NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H35F6N3OSSi/c1-15(33-35(5,6)21(2,3)4)19(14-32-9-7-8-10-32)31-20(34)30-18-12-16(22(24,25)26)11-17(13-18)23(27,28)29/h11-13,15,19H,7-10,14H2,1-6H3,(H2,30,31,34)/t15-,19+/m0/s1 |
| InChIKey | JNPSGXLYYHBWGT-HNAYVOBHSA-N |
| XLogP | 6.89 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|