About dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate
dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate (PubChem CID 138965830) has the molecular formula C17H26O4
and a molecular weight of 294.39 g/mol. Its IUPAC name is dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate |
| PubChem CID | 138965830 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C(CCC=C(C)C)C1CCC(C(=O)OC)(C(=O)OC)C1 |
| InChI | InChI=1S/C17H26O4/c1-12(2)7-6-8-13(3)14-9-10-17(11-14,15(18)20-4)16(19)21-5/h7,14H,3,6,8-11H2,1-2,4-5H3 |
| InChIKey | WYKVOFIRPBDNLX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate?
The IUPAC name of dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate (CID 138965830) is dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate.
What is the SMILES notation for dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate?
The canonical SMILES for dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate is C=C(CCC=C(C)C)C1CCC(C(=O)OC)(C(=O)OC)C1.
What is the InChIKey of dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate?
The InChIKey is WYKVOFIRPBDNLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4/c1-12(2)7-6-8-13(3)14-9-10-17(11-14,15(18)20-4)16(19)21-5/h7,14H,3,6,8-11H2,1-2,4-5H3.
What are the key properties of dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate?
dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate has a molecular weight of 294.39 g/mol, XLogP of 3.42, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-(6-methylhepta-1,5-dien-2-yl)cyclopentane-1,1-dicarboxylate is sourced from PubChem (CID 138965830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).