C18H20N2O2 — CID 138965842
(2S,3Z)-3-hydroxyimino-2,3-diphenyl-N-propylpropanamide (PubChem CID 138965842) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2S,3Z)-3-hydroxyimino-2,3-diphenyl-N-propylpropanamide.
| Compound Name | (2S,3Z)-3-hydroxyimino-2,3-diphenyl-N-propylpropanamide |
|---|---|
| PubChem CID | 138965842 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2S,3Z)-3-hydroxyimino-2,3-diphenyl-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@H](/C(=N/O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c1-2-13-19-18(21)16(14-9-5-3-6-10-14)17(20-22)15-11-7-4-8-12-15/h3-12,16,22H,2,13H2,1H3,(H,19,21)/b20-17+/t16-/m0/s1 |
| InChIKey | VKLOGCPZHKFXFW-TXCMAPRMSA-N |
| XLogP | 3.17 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|