C28H35NO7 — CID 138966012
ethyl (4S,5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-(benzylamino)-4-hydroxypent-2-enoate (PubChem CID 138966012) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is ethyl (4S,5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-(benzylamino)-4-hydroxypent-2-enoate.
| Compound Name | ethyl (4S,5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-(benzylamino)-4-hydroxypent-2-enoate |
|---|---|
| PubChem CID | 138966012 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | ethyl (4S,5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-(benzylamino)-4-hydroxypent-2-enoate |
| SMILES | CCOC(=O)C=C[C@H](O)[C@H](NCc1ccccc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H35NO7/c1-4-32-22(31)16-15-21(30)23(29-17-19-11-7-5-8-12-19)24-25(33-18-20-13-9-6-10-14-20)26-27(34-24)36-28(2,3)35-26/h5-16,21,23-27,29-30H,4,17-18H2,1-3H3/t21-,23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | WGVVFWIGEKEHNW-VKVVYBDYSA-N |
| XLogP | 3.09 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|