C16H10I2 — CID 138966123
2,4-diiodo-1-phenylnaphthalene (PubChem CID 138966123) has the molecular formula C16H10I2 and a molecular weight of 456.06 g/mol. Its IUPAC name is 2,4-diiodo-1-phenylnaphthalene.
| Compound Name | 2,4-diiodo-1-phenylnaphthalene |
|---|---|
| PubChem CID | 138966123 |
| Molecular Formula | C16H10I2 |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 455.89 |
| IUPAC Name | 2,4-diiodo-1-phenylnaphthalene |
| SMILES | Ic1cc(I)c2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C16H10I2/c17-14-10-15(18)16(11-6-2-1-3-7-11)13-9-5-4-8-12(13)14/h1-10H |
| InChIKey | SHQPZOZIWDMWGK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|