C21H36O4Si — CID 138966271
(4aS,5S,8S,8aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(methoxymethoxy)-2,4a-dimethyl-4,5,8,8a-tetrahydronaphthalen-1-one (PubChem CID 138966271) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (4aS,5S,8S,8aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(methoxymethoxy)-2,4a-dimethyl-4,5,8,8a-tetrahydronaphthalen-1-one.
| Compound Name | (4aS,5S,8S,8aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(methoxymethoxy)-2,4a-dimethyl-4,5,8,8a-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 138966271 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (4aS,5S,8S,8aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(methoxymethoxy)-2,4a-dimethyl-4,5,8,8a-tetrahydronaphthalen-1-one |
| SMILES | COCO[C@H]1C=C[C@H](CO[Si](C)(C)C(C)(C)C)[C@]2(C)CC=C(C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C21H36O4Si/c1-15-11-12-21(5)16(13-25-26(7,8)20(2,3)4)9-10-17(24-14-23-6)18(21)19(15)22/h9-11,16-18H,12-14H2,1-8H3/t16-,17+,18-,21+/m1/s1 |
| InChIKey | RWJQNMAQWPVVKS-IIMDRIAPSA-N |
| XLogP | 4.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|