C20H20O3S — CID 138966369
6-[(4-methylphenyl)sulfonyl-phenylmethyl]cyclohexa-2,4-dien-1-ol (PubChem CID 138966369) has the molecular formula C20H20O3S and a molecular weight of 340.44 g/mol. Its IUPAC name is 6-[(4-methylphenyl)sulfonyl-phenylmethyl]cyclohexa-2,4-dien-1-ol.
| Compound Name | 6-[(4-methylphenyl)sulfonyl-phenylmethyl]cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 138966369 |
| Molecular Formula | C20H20O3S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 6-[(4-methylphenyl)sulfonyl-phenylmethyl]cyclohexa-2,4-dien-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)C(c2ccccc2)C2C=CC=CC2O)cc1 |
| InChI | InChI=1S/C20H20O3S/c1-15-11-13-17(14-12-15)24(22,23)20(16-7-3-2-4-8-16)18-9-5-6-10-19(18)21/h2-14,18-21H,1H3 |
| InChIKey | LWJUIDDKJGNUSX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |