About 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one
9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one (PubChem CID 138966379) has the molecular formula C16H24O2
and a molecular weight of 248.37 g/mol. Its IUPAC name is 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one.
Molecular Properties
| Compound Name | 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one |
| PubChem CID | 138966379 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one |
| SMILES | C=CCC12CCC(=O)C(C)(C=C1C)CC2COC |
| InChI | InChI=1S/C16H24O2/c1-5-7-16-8-6-14(17)15(3,9-12(16)2)10-13(16)11-18-4/h5,9,13H,1,6-8,10-11H2,2-4H3 |
| InChIKey | GUMHFHTWHQAYMP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one?
The IUPAC name of 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one (CID 138966379) is 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one.
What is the SMILES notation for 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one?
The canonical SMILES for 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one is C=CCC12CCC(=O)C(C)(C=C1C)CC2COC.
What is the InChIKey of 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one?
The InChIKey is GUMHFHTWHQAYMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O2/c1-5-7-16-8-6-14(17)15(3,9-12(16)2)10-13(16)11-18-4/h5,9,13H,1,6-8,10-11H2,2-4H3.
What are the key properties of 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one?
9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one has a molecular weight of 248.37 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(methoxymethyl)-1,6-dimethyl-5-prop-2-enylbicyclo[3.2.2]non-6-en-2-one is sourced from PubChem (CID 138966379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).