About (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one
(5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one (PubChem CID 138966385) has the molecular formula C8H11N2OS+
and a molecular weight of 183.26 g/mol. Its IUPAC name is (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one |
| PubChem CID | 138966385 |
| Molecular Formula | C8H11N2OS+ |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](C[n+]2ccsc2)N1 |
| InChI | InChI=1S/C8H10N2OS/c11-8-2-1-7(9-8)5-10-3-4-12-6-10/h3-4,6-7H,1-2,5H2/p+1/t7-/m1/s1 |
| InChIKey | NHDSPPVZXHDAKP-SSDOTTSWSA-O |
| XLogP | 0.31 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one?
The IUPAC name of (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one (CID 138966385) is (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one.
What is the SMILES notation for (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one?
The canonical SMILES for (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one is O=C1CC[C@H](C[n+]2ccsc2)N1.
What is the InChIKey of (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one?
The InChIKey is NHDSPPVZXHDAKP-SSDOTTSWSA-O. The full InChI is InChI=1S/C8H10N2OS/c11-8-2-1-7(9-8)5-10-3-4-12-6-10/h3-4,6-7H,1-2,5H2/p+1/t7-/m1/s1.
What are the key properties of (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one?
(5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one has a molecular weight of 183.26 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(1,3-thiazol-3-ium-3-ylmethyl)pyrrolidin-2-one is sourced from PubChem (CID 138966385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).