About [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate
[(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate (PubChem CID 138966455) has the molecular formula C20H23O6PS
and a molecular weight of 422.44 g/mol. Its IUPAC name is [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate.
Molecular Properties
| Compound Name | [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate |
| PubChem CID | 138966455 |
| Molecular Formula | C20H23O6PS |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C\C=C\S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23O6PS/c1-3-24-27(21,25-4-2)26-20(18-12-7-5-8-13-18)16-11-17-28(22,23)19-14-9-6-10-15-19/h5-17H,3-4H2,1-2H3/b17-11+,20-16- |
| InChIKey | FVBUBEOWEMHVPW-IJKLSFDZSA-N |
| XLogP | 5.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate?
The IUPAC name of [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate (CID 138966455) is [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate.
What is the SMILES notation for [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate?
The canonical SMILES for [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate is CCOP(=O)(OCC)O/C(=C\C=C\S(=O)(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate?
The InChIKey is FVBUBEOWEMHVPW-IJKLSFDZSA-N. The full InChI is InChI=1S/C20H23O6PS/c1-3-24-27(21,25-4-2)26-20(18-12-7-5-8-13-18)16-11-17-28(22,23)19-14-9-6-10-15-19/h5-17H,3-4H2,1-2H3/b17-11+,20-16-.
What are the key properties of [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate?
[(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate has a molecular weight of 422.44 g/mol, XLogP of 5.21, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z,3E)-4-(benzenesulfonyl)-1-phenylbuta-1,3-dienyl] diethyl phosphate is sourced from PubChem (CID 138966455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).