About (4Z)-4-hexylidene-1,3-dithiolan-2-one
(4Z)-4-hexylidene-1,3-dithiolan-2-one (PubChem CID 138966480) has the molecular formula C9H14OS2
and a molecular weight of 202.34 g/mol. Its IUPAC name is (4Z)-4-hexylidene-1,3-dithiolan-2-one.
Molecular Properties
| Compound Name | (4Z)-4-hexylidene-1,3-dithiolan-2-one |
| PubChem CID | 138966480 |
| Molecular Formula | C9H14OS2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | (4Z)-4-hexylidene-1,3-dithiolan-2-one |
| SMILES | CCCCC/C=C1/CSC(=O)S1 |
| InChI | InChI=1S/C9H14OS2/c1-2-3-4-5-6-8-7-11-9(10)12-8/h6H,2-5,7H2,1H3/b8-6- |
| InChIKey | GMIDLZFOHHEODI-VURMDHGXSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-hexylidene-1,3-dithiolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-hexylidene-1,3-dithiolan-2-one?
The IUPAC name of (4Z)-4-hexylidene-1,3-dithiolan-2-one (CID 138966480) is (4Z)-4-hexylidene-1,3-dithiolan-2-one.
What is the SMILES notation for (4Z)-4-hexylidene-1,3-dithiolan-2-one?
The canonical SMILES for (4Z)-4-hexylidene-1,3-dithiolan-2-one is CCCCC/C=C1/CSC(=O)S1.
What is the InChIKey of (4Z)-4-hexylidene-1,3-dithiolan-2-one?
The InChIKey is GMIDLZFOHHEODI-VURMDHGXSA-N. The full InChI is InChI=1S/C9H14OS2/c1-2-3-4-5-6-8-7-11-9(10)12-8/h6H,2-5,7H2,1H3/b8-6-.
What are the key properties of (4Z)-4-hexylidene-1,3-dithiolan-2-one?
(4Z)-4-hexylidene-1,3-dithiolan-2-one has a molecular weight of 202.34 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-hexylidene-1,3-dithiolan-2-one is sourced from PubChem (CID 138966480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).