C16H24O2 — CID 138966582
(3aR,4R,7aR)-4-(methoxymethyl)-6,7a-dimethyl-3a-prop-2-enyl-2,3,4,5-tetrahydroinden-1-one (PubChem CID 138966582) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3aR,4R,7aR)-4-(methoxymethyl)-6,7a-dimethyl-3a-prop-2-enyl-2,3,4,5-tetrahydroinden-1-one.
| Compound Name | (3aR,4R,7aR)-4-(methoxymethyl)-6,7a-dimethyl-3a-prop-2-enyl-2,3,4,5-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 138966582 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (3aR,4R,7aR)-4-(methoxymethyl)-6,7a-dimethyl-3a-prop-2-enyl-2,3,4,5-tetrahydroinden-1-one |
| SMILES | C=CC[C@@]12CCC(=O)[C@]1(C)C=C(C)C[C@H]2COC |
| InChI | InChI=1S/C16H24O2/c1-5-7-16-8-6-14(17)15(16,3)10-12(2)9-13(16)11-18-4/h5,10,13H,1,6-9,11H2,2-4H3/t13-,15-,16-/m0/s1 |
| InChIKey | PKBCDRLRBICOQS-BPUTZDHNSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|