C16H19ClO2 — CID 138966693
(4-chlorophenyl)-(2,2-dimethyl-1-oxaspiro[2.5]octan-6-yl)methanone (PubChem CID 138966693) has the molecular formula C16H19ClO2 and a molecular weight of 278.78 g/mol. Its IUPAC name is (4-chlorophenyl)-(2,2-dimethyl-1-oxaspiro[2.5]octan-6-yl)methanone.
| Compound Name | (4-chlorophenyl)-(2,2-dimethyl-1-oxaspiro[2.5]octan-6-yl)methanone |
|---|---|
| PubChem CID | 138966693 |
| Molecular Formula | C16H19ClO2 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (4-chlorophenyl)-(2,2-dimethyl-1-oxaspiro[2.5]octan-6-yl)methanone |
| SMILES | CC1(C)OC12CCC(C(=O)c1ccc(Cl)cc1)CC2 |
| InChI | InChI=1S/C16H19ClO2/c1-15(2)16(19-15)9-7-12(8-10-16)14(18)11-3-5-13(17)6-4-11/h3-6,12H,7-10H2,1-2H3 |
| InChIKey | FHWJHMSLALZCRC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|