C17H28O6 — CID 138966814
tert-butyl (E)-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 138966814) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl (E)-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 138966814 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | tert-butyl (E)-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H28O6/c1-15(2,3)22-13(18)9-8-11-14(23-17(6,7)20-11)12-10-19-16(4,5)21-12/h8-9,11-12,14H,10H2,1-7H3/b9-8+/t11-,12-,14+/m1/s1 |
| InChIKey | BHJDNDYUGYJBTJ-ZDADHWFXSA-N |
| XLogP | 2.56 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|