C21H33BrO2 — CID 138966920
methyl (E)-5-[(4aS,6R,8aR)-6-bromo-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enoate (PubChem CID 138966920) has the molecular formula C21H33BrO2 and a molecular weight of 397.40 g/mol. Its IUPAC name is methyl (E)-5-[(4aS,6R,8aR)-6-bromo-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enoate.
| Compound Name | methyl (E)-5-[(4aS,6R,8aR)-6-bromo-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 138966920 |
| Molecular Formula | C21H33BrO2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | methyl (E)-5-[(4aS,6R,8aR)-6-bromo-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enoate |
| SMILES | COC(=O)/C=C(\C)CCC1=C(C)CC[C@@H]2C(C)(C)[C@H](Br)CC[C@@]12C |
| InChI | InChI=1S/C21H33BrO2/c1-14(13-19(23)24-6)7-9-16-15(2)8-10-17-20(3,4)18(22)11-12-21(16,17)5/h13,17-18H,7-12H2,1-6H3/b14-13+/t17-,18-,21+/m1/s1 |
| InChIKey | XGYBBXSLWNXBTI-OWQOGVFLSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|