C17H21NO2 — CID 138967028
(E)-N-[4-(hydroxymethyl)hepta-1,6-dien-4-yl]-3-phenylprop-2-enamide (PubChem CID 138967028) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (E)-N-[4-(hydroxymethyl)hepta-1,6-dien-4-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-(hydroxymethyl)hepta-1,6-dien-4-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 138967028 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (E)-N-[4-(hydroxymethyl)hepta-1,6-dien-4-yl]-3-phenylprop-2-enamide |
| SMILES | C=CCC(CO)(CC=C)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H21NO2/c1-3-12-17(14-19,13-4-2)18-16(20)11-10-15-8-6-5-7-9-15/h3-11,19H,1-2,12-14H2,(H,18,20)/b11-10+ |
| InChIKey | QYMGPJUBRGUJFU-ZHACJKMWSA-N |
| XLogP | 2.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|