About ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate
ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate (PubChem CID 138967112) has the molecular formula C16H24O5
and a molecular weight of 296.36 g/mol. Its IUPAC name is ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate.
Molecular Properties
| Compound Name | ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate |
| PubChem CID | 138967112 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1CCC[C@H]1C(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C16H24O5/c1-4-20-14(18)10-9-12-7-6-8-13(12)15(11(3)17)16(19)21-5-2/h9-10,12-13,15H,4-8H2,1-3H3/b10-9+/t12-,13+,15?/m0/s1 |
| InChIKey | ITANNZDDQGSKNK-IEEJQKQXSA-N |
| XLogP | 2.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate?
The IUPAC name of ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate (CID 138967112) is ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate.
What is the SMILES notation for ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate?
The canonical SMILES for ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate is CCOC(=O)/C=C/[C@@H]1CCC[C@H]1C(C(C)=O)C(=O)OCC.
What is the InChIKey of ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate?
The InChIKey is ITANNZDDQGSKNK-IEEJQKQXSA-N. The full InChI is InChI=1S/C16H24O5/c1-4-20-14(18)10-9-12-7-6-8-13(12)15(11(3)17)16(19)21-5-2/h9-10,12-13,15H,4-8H2,1-3H3/b10-9+/t12-,13+,15?/m0/s1.
What are the key properties of ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate?
ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate has a molecular weight of 296.36 g/mol, XLogP of 2.29, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentyl]-3-oxobutanoate is sourced from PubChem (CID 138967112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).