C20H42O4Si — CID 138967169
(4S,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)dodec-1-en-4-ol (PubChem CID 138967169) has the molecular formula C20H42O4Si and a molecular weight of 374.64 g/mol. Its IUPAC name is (4S,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)dodec-1-en-4-ol.
| Compound Name | (4S,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)dodec-1-en-4-ol |
|---|---|
| PubChem CID | 138967169 |
| Molecular Formula | C20H42O4Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | (4S,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)dodec-1-en-4-ol |
| SMILES | C=CC[C@H](O)[C@H](C[C@@H](CCCCC)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C20H42O4Si/c1-9-11-12-14-17(24-25(7,8)20(3,4)5)15-19(23-16-22-6)18(21)13-10-2/h10,17-19,21H,2,9,11-16H2,1,3-8H3/t17-,18+,19+/m1/s1 |
| InChIKey | QQAQNOFADOXXME-QYZOEREBSA-N |
| XLogP | 5.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|