About CID 138967245
CID 138967245 (PubChem CID 138967245) has the molecular formula C13H10FNSi
and a molecular weight of 227.31 g/mol.
Molecular Properties
| Compound Name | CID 138967245 |
| PubChem CID | 138967245 |
| Molecular Formula | C13H10FNSi |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | — |
| SMILES | Fc1ccc(/C=C/[Si]c2ccccn2)cc1 |
| InChI | InChI=1S/C13H10FNSi/c14-12-6-4-11(5-7-12)8-10-16-13-3-1-2-9-15-13/h1-10H/b10-8+ |
| InChIKey | HTRCZJITCNWTSW-CSKARUKUSA-N |
| XLogP | 2.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 138967245 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138967245?
The IUPAC name of CID 138967245 (CID 138967245) is not available.
What is the SMILES notation for CID 138967245?
The canonical SMILES for CID 138967245 is Fc1ccc(/C=C/[Si]c2ccccn2)cc1.
What is the InChIKey of CID 138967245?
The InChIKey is HTRCZJITCNWTSW-CSKARUKUSA-N. The full InChI is InChI=1S/C13H10FNSi/c14-12-6-4-11(5-7-12)8-10-16-13-3-1-2-9-15-13/h1-10H/b10-8+.
What are the key properties of CID 138967245?
CID 138967245 has a molecular weight of 227.31 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138967245 is sourced from PubChem (CID 138967245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).